Difference between revisions of "5-AMINO-LEVULINATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-AMINO-LEVULINATE 5-AMINO-LEVULINATE] == * smiles: ** C(C(C[N+])=O)CC([O-])=O * common name: *...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-AMINO-LEVULINATE 5-AMINO-LEVULINATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C(C[N+])=O)CC([O-])=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 5-aminolevulinate |
+ | * inchi key: | ||
+ | ** InChIKey=ZGXJTSGNIOSYLO-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 131.131 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5-amino-4-oxopentanoate |
− | ** | + | ** 5-amino-4-oxo-pentanoic acid |
− | ** | + | ** 5-amino-levulinic acid |
− | ** | + | ** 5-amino-4-oxopentanoic acid |
+ | ** δ-aminolevulinate | ||
+ | ** 5-aminolevulinic acid | ||
+ | ** 5-amino-levulinate | ||
+ | ** ALA | ||
+ | ** δ-aminolevulinic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PORPHOBILSYNTH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GSAAMINOTRANS-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * CAS : 106-60-5 |
+ | * BIGG : 5aop | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7048523 7048523] |
− | * | + | * HMDB : HMDB01149 |
− | ** [http://www. | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00430 C00430] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=356416 356416] |
− | {{#set: molecular weight= | + | * METABOLIGHTS : MTBLC356416 |
− | {{#set: common name= | + | {{#set: smiles=C(C(C[N+])=O)CC([O-])=O}} |
− | {{#set: consumed by= | + | {{#set: common name=5-aminolevulinate}} |
− | {{#set: produced by= | + | {{#set: inchi key=InChIKey=ZGXJTSGNIOSYLO-UHFFFAOYSA-N}} |
+ | {{#set: molecular weight=131.131 }} | ||
+ | {{#set: common name=5-amino-4-oxopentanoate|5-amino-4-oxo-pentanoic acid|5-amino-levulinic acid|5-amino-4-oxopentanoic acid|δ-aminolevulinate|5-aminolevulinic acid|5-amino-levulinate|ALA|δ-aminolevulinic acid}} | ||
+ | {{#set: consumed by=PORPHOBILSYNTH-RXN}} | ||
+ | {{#set: produced by=GSAAMINOTRANS-RXN}} |
Latest revision as of 19:27, 21 March 2018
Contents
Metabolite 5-AMINO-LEVULINATE
- smiles:
- C(C(C[N+])=O)CC([O-])=O
- common name:
- 5-aminolevulinate
- inchi key:
- InChIKey=ZGXJTSGNIOSYLO-UHFFFAOYSA-N
- molecular weight:
- 131.131
- Synonym(s):
- 5-amino-4-oxopentanoate
- 5-amino-4-oxo-pentanoic acid
- 5-amino-levulinic acid
- 5-amino-4-oxopentanoic acid
- δ-aminolevulinate
- 5-aminolevulinic acid
- 5-amino-levulinate
- ALA
- δ-aminolevulinic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 106-60-5
- BIGG : 5aop
- PUBCHEM:
- HMDB : HMDB01149
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC356416
"C(C(C[N+])=O)CC([O-])=O" cannot be used as a page name in this wiki.