Difference between revisions of "PWY-6118"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] == * smiles: ** CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6118 PWY-6118] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6118 PWY-6118] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** glycerol-3-phosphate shuttle |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** G3P shuttle | ||
| + | ** glycerol-3-P shuttle | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[1.1.1.8-RXN]] |
| − | == Reaction(s) | + | ** 6 associated gene(s): |
| + | *** [[Tiso_gene_6069]] | ||
| + | *** [[Tiso_gene_3718]] | ||
| + | *** [[Tiso_gene_2810]] | ||
| + | *** [[Tiso_gene_2811]] | ||
| + | *** [[Tiso_gene_13013]] | ||
| + | *** [[Tiso_gene_15777]] | ||
| + | ** 6 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | * [[RXN-15745]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_15777]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=glycerol-3-phosphate shuttle}} | |
| − | {{#set: | + | {{#set: common name=G3P shuttle|glycerol-3-P shuttle}} |
| − | {{#set: | + | {{#set: reaction found=2}} |
| − | {{#set: common name= | + | {{#set: total reaction=2}} |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
Latest revision as of 19:48, 21 March 2018
Pathway PWY-6118
- taxonomic range:
- common name:
- glycerol-3-phosphate shuttle
- Synonym(s):
- G3P shuttle
- glycerol-3-P shuttle
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- 1.1.1.8-RXN
- 6 associated gene(s):
- 6 reconstruction source(s) associated:
- RXN-15745
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
