Difference between revisions of "CPD-9758"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7761 PWY-7761] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9758 CPD-9758] == * smiles: ** CC(=CCCC(=CCOC(C)=O)C)C * common name: ** geranyl acetate *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9758 CPD-9758] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCOC(C)=O)C)C |
* common name: | * common name: | ||
− | ** | + | ** geranyl acetate |
+ | * inchi key: | ||
+ | ** InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N | ||
+ | * molecular weight: | ||
+ | ** 196.289 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** geraniol acetate |
+ | ** neryl acetate | ||
+ | ** geranyl acetate, cis- | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-9192]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549026 1549026] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.1266019.html 1266019] |
− | {{#set: | + | * HMDB : HMDB35157 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=5331 5331] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C09861 C09861] | ||
+ | {{#set: smiles=CC(=CCCC(=CCOC(C)=O)C)C}} | ||
+ | {{#set: common name=geranyl acetate}} | ||
+ | {{#set: inchi key=InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N}} | ||
+ | {{#set: molecular weight=196.289 }} | ||
+ | {{#set: common name=geraniol acetate|neryl acetate|geranyl acetate, cis-}} | ||
+ | {{#set: produced by=RXN-9192}} |
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite CPD-9758
- smiles:
- CC(=CCCC(=CCOC(C)=O)C)C
- common name:
- geranyl acetate
- inchi key:
- InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N
- molecular weight:
- 196.289
- Synonym(s):
- geraniol acetate
- neryl acetate
- geranyl acetate, cis-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links