Difference between revisions of "PWY-5515"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5515 PWY-5515] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5515 PWY-5515] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-arabinose degradation II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''1''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[RXN-8772]] | |
| − | * [[ | + | ** 4 associated gene(s): |
| − | == Reaction(s) | + | *** [[Tiso_gene_8988]] |
| − | * [ | + | *** [[Tiso_gene_7799]] |
| + | *** [[Tiso_gene_7800]] | ||
| + | *** [[Tiso_gene_18748]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=L-ARABINITOL-4-DEHYDROGENASE-RXN L-ARABINITOL-4-DEHYDROGENASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=L-XYLULOSE-REDUCTASE-RXN L-XYLULOSE-REDUCTASE-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=L-arabinose degradation II}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:48, 21 March 2018
Pathway PWY-5515
- taxonomic range:
- common name:
- L-arabinose degradation II
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN-8772
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
