Difference between revisions of "RXN0-1081"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLN GLN] == * smiles: ** C(=O)(N)CCC([N+])C([O-])=O * inchi key: ** InChIKey=ZDXPYRJPNDTMRX-VKH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1081 RXN0-1081] == * direction: ** LEFT-TO-RIGHT * common name: ** trna-specific_adenosinedeam...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1081 RXN0-1081] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** trna-specific_adenosinedeaminase |
− | * | + | ** trna_specific_adenosine_deaminase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/3.5.4 EC-3.5.4] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * | + | ** 1 [[tRNA-Arg-adenosine34]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[tRNA-Arg-inosine34]][c] '''+''' 1 [[AMMONIUM]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 an adenosine34 in [tRNAArg2][c] '''+''' 1 H+[c] '''+''' 1 H2O[c] '''=>''' 1 an inosine34 in [tRNAArg2][c] '''+''' 1 ammonium[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[Tiso_gene_6521]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: AUTOMATED-NAME-MATCH | |
− | + | * Gene: [[Tiso_gene_7736]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: AUTOMATED-NAME-MATCH |
− | * | + | == Pathways == |
− | * [[ | + | == Reconstruction information == |
− | + | * Category: [[annotation]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * | + | *** Tool: [[pathwaytools]] |
− | == | + | |
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=trna-specific_adenosinedeaminase}} | |
− | + | {{#set: common name=trna_specific_adenosine_deaminase}} | |
− | + | {{#set: ec number=EC-3.5.4}} | |
− | + | {{#set: gene associated=Tiso_gene_6521|Tiso_gene_7736}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:48, 21 March 2018
Contents
Reaction RXN0-1081
- direction:
- LEFT-TO-RIGHT
- common name:
- trna-specific_adenosinedeaminase
- trna_specific_adenosine_deaminase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 tRNA-Arg-adenosine34[c] + 1 PROTON[c] + 1 WATER[c] => 1 tRNA-Arg-inosine34[c] + 1 AMMONIUM[c]
- With common name(s):
- 1 an adenosine34 in [tRNAArg2][c] + 1 H+[c] + 1 H2O[c] => 1 an inosine34 in [tRNAArg2][c] + 1 ammonium[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6521
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_7736
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation