Difference between revisions of "Oxidized-Factor-F420"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-Factor-F420 Oxidized-Factor-F420] == * common name: ** an oxidized coenzyme F420 * Syn...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-Factor-F420 Oxidized-Factor-F420] ==
−
* smiles:
+
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J
+
 
* common name:
 
* common name:
−
** 18-hydroxyoleoyl-CoA
+
** an oxidized coenzyme F420
−
* molecular weight:
+
−
** 1043.952   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (9Z)-18-hydroxyoctadec-9-enoyl-CoA
+
** an oxidized factor F420
−
** ω-hydroxyoleoyl-CoA
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16402]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[COENZYME-F420-HYDROGENASE-RXN]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an oxidized coenzyme F420}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820566 91820566]
+
{{#set: common name=an oxidized factor F420}}
−
* CHEBI:
+
{{#set: reversible reaction associated=COENZYME-F420-HYDROGENASE-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86044 86044]
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J}}
+
−
{{#set: common name=18-hydroxyoleoyl-CoA}}
+
−
{{#set: molecular weight=1043.952    }}
+
−
{{#set: common name=(9Z)-18-hydroxyoctadec-9-enoyl-CoA|ω-hydroxyoleoyl-CoA}}
+
−
{{#set: produced by=RXN-16402}}
+

Latest revision as of 20:48, 21 March 2018

Metabolite Oxidized-Factor-F420

  • common name:
    • an oxidized coenzyme F420
  • Synonym(s):
    • an oxidized factor F420

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Oxidized-Factor-F420&oldid=43912"