Difference between revisions of "PWY4FS-12"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * smiles: ** CC(=O)NC(CCSC)C([O-])=O * inchi key: ** InChIKey=XUYPXLNMD...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-12 PWY4FS-12] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-12 PWY4FS-12] ==
* smiles:
+
* taxonomic range:
** CC(=O)NC(CCSC)C([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
+
 
* common name:
 
* common name:
** Nα-acetyl-L-methionine
+
** VTC2 cycle
* molecular weight:
+
** 190.237   
+
 
* Synonym(s):
 
* Synonym(s):
** N-acetyl-L-methionine
+
** GDP-D-mannose biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
* [[RXN0-6948]]
+
* [[RXN-1882]]
* [[RXN-17893]]
+
** 1 associated gene(s):
* [[RXN-17892]]
+
*** [[Tiso_gene_6621]]
== Reaction(s) of unknown directionality ==
+
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN4FS-12 RXN4FS-12]
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB01646
+
{{#set: taxonomic range=TAX-33090}}
* PUBCHEM:
+
{{#set: common name=VTC2 cycle}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991985 6991985]
+
{{#set: common name=GDP-D-mannose biosynthesis}}
* HMDB : HMDB11745
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C02712 C02712]
+
{{#set: completion rate=50.0}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.395338.html 395338]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71670 71670]
+
{{#set: smiles=CC(=O)NC(CCSC)C([O-])=O}}
+
{{#set: inchi key=InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M}}
+
{{#set: common name=Nα-acetyl-L-methionine}}
+
{{#set: molecular weight=190.237    }}
+
{{#set: common name=N-acetyl-L-methionine}}
+
{{#set: produced by=RXN0-6948|RXN-17893|RXN-17892}}
+

Latest revision as of 19:48, 21 March 2018

Pathway PWY4FS-12

  • taxonomic range:
  • common name:
    • VTC2 cycle
  • Synonym(s):
    • GDP-D-mannose biosynthesis

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links