Difference between revisions of "CPD0-2015"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTPOP GTPOP] == * direction: ** LEFT-TO-RIGHT * common name: ** GTP:pyruvate 2-O-phosphotransferase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * smiles: ** CC(=O)NC(CCSC)C([O-])=O * common name: ** Nα-acetyl-...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=O)NC(CCSC)C([O-])=O |
* common name: | * common name: | ||
| − | ** | + | ** Nα-acetyl-L-methionine |
| + | * inchi key: | ||
| + | ** InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M | ||
| + | * molecular weight: | ||
| + | ** 190.237 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** N-acetyl-L-methionine | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN0-6948]] | |
| − | + | * [[RXN-17893]] | |
| − | * | + | * [[RXN-17892]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * DRUGBANK : DB01646 | |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991985 6991985] |
| − | {{#set: | + | * HMDB : HMDB11745 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02712 C02712] |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.395338.html 395338] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71670 71670] | ||
| + | {{#set: smiles=CC(=O)NC(CCSC)C([O-])=O}} | ||
| + | {{#set: common name=Nα-acetyl-L-methionine}} | ||
| + | {{#set: inchi key=InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M}} | ||
| + | {{#set: molecular weight=190.237 }} | ||
| + | {{#set: common name=N-acetyl-L-methionine}} | ||
| + | {{#set: produced by=RXN0-6948|RXN-17893|RXN-17892}} | ||
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite CPD0-2015
- smiles:
- CC(=O)NC(CCSC)C([O-])=O
- common name:
- Nα-acetyl-L-methionine
- inchi key:
- InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
- molecular weight:
- 190.237
- Synonym(s):
- N-acetyl-L-methionine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- DRUGBANK : DB01646
- PUBCHEM:
- HMDB : HMDB11745
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"CC(=O)NC(CCSC)C([O-])=O" cannot be used as a page name in this wiki.
