Difference between revisions of "Tiso gene 8798"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] == * smiles: ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(...")
(Created page with "Category:Gene == Gene Tiso_gene_8798 == * right end position: ** 7301 * transcription direction: ** NEGATIVE * left end position: ** 4068 * centisome position: ** 41.22416...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] ==
+
== Gene Tiso_gene_8798 ==
−
* smiles:
+
* right end position:
−
** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
+
** 7301
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** L-thyroxine phenolic β-D-glucuronide
+
** 4068
−
* molecular weight:
+
* centisome position:
−
** 951.992    
+
** 41.22416    
 
* Synonym(s):
 
* Synonym(s):
−
** L-thyroxine phenolic glucuronide
 
−
** thyroxine glucuronide
 
−
** beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-
 
−
** T4G
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[HISTIDINE--TRNA-LIGASE-RXN]]
−
* [[RXN-10606]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=7301}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237176 44237176]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))}}
+
{{#set: left end position=4068}}
−
{{#set: inchi key=InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M}}
+
{{#set: centisome position=41.22416   }}
−
{{#set: common name=L-thyroxine phenolic β-D-glucuronide}}
+
{{#set: reaction associated=HISTIDINE--TRNA-LIGASE-RXN}}
−
{{#set: molecular weight=951.992   }}
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
−
{{#set: common name=L-thyroxine phenolic glucuronide|thyroxine glucuronide|beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-|T4G}}
+
−
{{#set: produced by=RXN-10606}}
+

Latest revision as of 19:49, 21 March 2018

Gene Tiso_gene_8798

  • right end position:
    • 7301
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 4068
  • centisome position:
    • 41.22416
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8798&oldid=43978"