Difference between revisions of "5-10-METHENYL-THF-GLU-N"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-10-METHENYL-THF-GLU-N 5-10-METHENYL-THF-GLU-N] == * common name: ** a 5,10-methenyltetrahydro...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-10-METHENYL-THF-GLU-N 5-10-METHENYL-THF-GLU-N] ==
−
* smiles:
+
−
** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
+
−
* inchi key:
+
−
** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
+
 
* common name:
 
* common name:
−
** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
+
** a 5,10-methenyltetrahydrofolate
−
* molecular weight:
+
−
** 185.136   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
+
** a 5,10-methenyl-THF
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-14014]]
+
* [[RXN-6321]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[DIHYDRODIPICSYN-RXN]]
+
* [[RXN66-576]]
 +
* [[RXN66-577]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[METHENYLTHFCYCLOHYDRO-RXN]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a 5,10-methenyltetrahydrofolate}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847]
+
{{#set: common name=a 5,10-methenyl-THF}}
−
* CHEBI:
+
{{#set: consumed by=RXN-6321}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139]
+
{{#set: produced by=RXN66-576|RXN66-577}}
−
{{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}}
+
{{#set: reversible reaction associated=METHENYLTHFCYCLOHYDRO-RXN|METHYLENETHFDEHYDROG-NADP-RXN}}
−
{{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}}
+
−
{{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
+
−
{{#set: molecular weight=185.136    }}
+
−
{{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}}
+
−
{{#set: consumed by=RXN-14014}}
+
−
{{#set: produced by=DIHYDRODIPICSYN-RXN}}
+

Latest revision as of 19:49, 21 March 2018

Metabolite 5-10-METHENYL-THF-GLU-N

  • common name:
    • a 5,10-methenyltetrahydrofolate
  • Synonym(s):
    • a 5,10-methenyl-THF

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=5-10-METHENYL-THF-GLU-N&oldid=43981"