|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.25.1-RXN 3.4.25.1-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18491 CPD-18491] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
| * common name: | | * common name: |
− | ** 26S protease regulatory subunit 7 | + | ** (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA |
− | ** 26S protease regulatory subunit 8 homolog B | + | * inchi key: |
− | * ec number: | + | ** InChIKey=XZYNVQDKYRHKFG-QOJZHLSOSA-J |
− | ** [http://enzyme.expasy.org/EC/3.4.25.1 EC-3.4.25.1] | + | * molecular weight: |
| + | ** 1104.05 |
| * Synonym(s): | | * Synonym(s): |
| + | ** (6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-17113]] |
− | ** 1 [[WATER]][c] '''+''' 1 [[General-Protein-Substrates]][c] '''=>''' 1 [[Peptides-holder]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 H2O[c] '''+''' 1 a protein[c] '''=>''' 1 a peptide[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_2549]] | + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_18135]]
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_1855]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_5953]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_7332]]
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_16496]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_3310]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_11901]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_20415]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_19087]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_11443]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * UNIPROT: | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/Q7DLR9 Q7DLR9] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581137 71581137] |
− | ** [http://www.uniprot.org/uniprot/P28062 P28062]
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/Q9TRJ7 Q9TRJ7]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74084 74084] |
− | ** [http://www.uniprot.org/uniprot/P30656 P30656] | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
− | ** [http://www.uniprot.org/uniprot/P30657 P30657] | + | {{#set: common name=(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P28074 P28074]
| + | {{#set: inchi key=InChIKey=XZYNVQDKYRHKFG-QOJZHLSOSA-J}} |
− | ** [http://www.uniprot.org/uniprot/P40302 P40302]
| + | {{#set: molecular weight=1104.05 }} |
− | ** [http://www.uniprot.org/uniprot/O24633 O24633]
| + | {{#set: common name=(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P40303 P40303]
| + | {{#set: consumed by=RXN-17113}} |
− | ** [http://www.uniprot.org/uniprot/Q9V122 Q9V122]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40306 P40306]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28063 P28063]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25786 P25786]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28076 P28076]
| + | |
− | ** [http://www.uniprot.org/uniprot/O13268 O13268]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34064 P34064]
| + | |
− | ** [http://www.uniprot.org/uniprot/P60901 P60901]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18421 P18421]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18053 P18053]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28072 P28072]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22769 P22769]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25043 P25043]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28065 P28065]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30186 P30186]
| + | |
− | ** [http://www.uniprot.org/uniprot/P60900 P60900]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34065 P34065]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34067 P34067]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40301 P40301]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AVD2 Q8AVD2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7LZF1 Q7LZF1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40307 P40307]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23724 P23724]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28070 P28070]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22141 P22141]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49721 P49721]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49720 P49720]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25156 P25156]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09682 Q09682]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09720 Q09720]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48004 P48004]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38624 P38624]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32379 P32379]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7LZF0 Q7LZF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P62333 P62333]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q24178 Q24178]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27575 Q27575]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21242 P21242]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21243 P21243]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23638 P23638]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23639 P23639]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12881 P12881]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25787 P25787]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20618 P20618]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25788 P25788]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25789 P25789]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18420 P18420]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18422 P18422]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21670 P21670]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52428 P52428]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93395 P93395]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04861 O04861]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8LD27 Q8LD27]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48551 O48551]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24030 O24030]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42742 P42742]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81147 O81147]
| + | |
− | ** [http://www.uniprot.org/uniprot/O23708 O23708]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24616 O24616]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81149 O81149]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42134 Q42134]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34066 P34066]
| + | |
− | ** [http://www.uniprot.org/uniprot/O23712 O23712]
| + | |
− | ** [http://www.uniprot.org/uniprot/O23710 O23710]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7DLS1 Q7DLS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81153 O81153]
| + | |
− | ** [http://www.uniprot.org/uniprot/O23714 O23714]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}}
| + | |
− | {{#set: common name=26S protease regulatory subunit 7}} | + | |
− | {{#set: common name=26S protease regulatory subunit 8 homolog B}} | + | |
− | {{#set: ec number=EC-3.4.25.1}}
| + | |
− | {{#set: gene associated=Tiso_gene_2549|Tiso_gene_18135|Tiso_gene_1855|Tiso_gene_5953|Tiso_gene_7332|Tiso_gene_16496|Tiso_gene_3310|Tiso_gene_11901|Tiso_gene_20415|Tiso_gene_19087|Tiso_gene_11443}} | + | |
− | {{#set: in pathway=}} | + | |
− | {{#set: reconstruction category=orthology|annotation}}
| + | |
− | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus}}
| + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}} | + | |