Difference between revisions of "RIBOSE-15-BISPHOSPHATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-820 RXN1G-820] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delta1...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-15-BISPHOSPHATE RIBOSE-15-BISPHOSPHATE] == * smiles: ** C(C1(OC(C(C1O)O)OP([O-])([O-])=O...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-820 RXN1G-820] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-15-BISPHOSPHATE RIBOSE-15-BISPHOSPHATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O
 
* common name:
 
* common name:
−
** trans-delta2-cis,cis-delta17,29-C48:3-[acyl-carrier protein] reductase
+
** α-D-ribose 1,5-bisphosphate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4]
+
** InChIKey=AAAFZMYJJHWUPN-TXICZTDVSA-J
 +
* molecular weight:
 +
** 306.059   
 
* Synonym(s):
 
* Synonym(s):
 +
** ribose-1,5-bisphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN0-1401]]
−
** 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[trans-D2-cis-cis-D17-29-C48-3-ACPs]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[cis-cis-D17-29-C48-2-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 a trans-delta2-cis,cis-delta17,29-C48:3-[acp][c] '''=>''' 1 NAD+[c] '''+''' 1 a cis,cis-delta17,29-C48:2-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10778]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''86''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=trans-delta2-cis,cis-delta17,29-C48:3-[acyl-carrier protein] reductase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01151 C01151]
−
{{#set: ec number=EC-1.3.1.M4}}
+
* HMDB : HMDB11688
−
{{#set: gene associated=Tiso_gene_10778}}
+
* CHEBI:
−
{{#set: in pathway=PWYG-321}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68688 68688]
−
{{#set: reconstruction category=orthology}}
+
* BIGG : r15bp
−
{{#set: reconstruction tool=pantograph}}
+
* PUBCHEM:
−
{{#set: reconstruction source=esiliculosus}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678980 70678980]
 +
{{#set: smiles=C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O}}
 +
{{#set: common name=α-D-ribose 1,5-bisphosphate}}
 +
{{#set: inchi key=InChIKey=AAAFZMYJJHWUPN-TXICZTDVSA-J}}
 +
{{#set: molecular weight=306.059    }}
 +
{{#set: common name=ribose-1,5-bisphosphate}}
 +
{{#set: consumed by=RXN0-1401}}

Latest revision as of 19:27, 21 March 2018

Metabolite RIBOSE-15-BISPHOSPHATE

  • smiles:
    • C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O
  • common name:
    • α-D-ribose 1,5-bisphosphate
  • inchi key:
    • InChIKey=AAAFZMYJJHWUPN-TXICZTDVSA-J
  • molecular weight:
    • 306.059
  • Synonym(s):
    • ribose-1,5-bisphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RIBOSE-15-BISPHOSPHATE&oldid=41755"