Difference between revisions of "PWY-7268"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi ke...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7268 PWY-7268] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7268 PWY-7268] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** NAD/NADP-NADH/NADPH cytosolic interconversion (yeast) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''4''' reactions found over '''5''' reactions in the full pathway | |
| − | + | * [[GLU6PDEHYDROG-RXN]] | |
| − | * [[ | + | ** 2 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_16918]] |
| − | * [[ | + | *** [[Tiso_gene_14877]] |
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[ISOCITDEH-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_18262]] | ||
| + | *** [[Tiso_gene_10809]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[NAD-KIN-RXN]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[Tiso_gene_1163]] | ||
| + | *** [[Tiso_gene_14560]] | ||
| + | *** [[Tiso_gene_1420]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN0-3962]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=NADH-KINASE-RXN NADH-KINASE-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=NAD/NADP-NADH/NADPH cytosolic interconversion (yeast)}} | |
| − | + | {{#set: reaction found=4}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=80.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:49, 21 March 2018
Pathway PWY-7268
- taxonomic range:
- common name:
- NAD/NADP-NADH/NADPH cytosolic interconversion (yeast)
- Synonym(s):
Reaction(s) found
4 reactions found over 5 reactions in the full pathway
- GLU6PDEHYDROG-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- ISOCITDEH-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- NAD-KIN-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN0-3962
- 0 associated gene:
- 1 reconstruction source(s) associated:
