Difference between revisions of "CPD-11398"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_322 == * left end position: ** 22442 * transcription direction: ** POSITIVE * right end position: ** 28180 * centisome position: ** 62.9473...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] == * smiles: ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_322 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] ==
−
* left end position:
+
* smiles:
−
** 22442
+
** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** L-thyroxine phenolic β-D-glucuronide
−
* right end position:
+
* inchi key:
−
** 28180
+
** InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M
−
* centisome position:
+
* molecular weight:
−
** 62.94738    
+
** 951.992    
 
* Synonym(s):
 
* Synonym(s):
 +
** L-thyroxine phenolic glucuronide
 +
** thyroxine glucuronide
 +
** beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-
 +
** T4G
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[2.4.1.32-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-10606]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[RXN-16648]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
== Pathways associated ==
+
−
* [[PWY-7817]]
+
−
* [[PWY-7666]]
+
−
* [[PWY-1001]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=22442}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237176 44237176]
−
{{#set: right end position=28180}}
+
{{#set: smiles=C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))}}
−
{{#set: centisome position=62.94738   }}
+
{{#set: common name=L-thyroxine phenolic β-D-glucuronide}}
−
{{#set: reaction associated=2.4.1.32-RXN|CELLULOSE-SYNTHASE-UDP-FORMING-RXN|RXN-16648}}
+
{{#set: inchi key=InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M}}
−
{{#set: pathway associated=PWY-7817|PWY-7666|PWY-1001}}
+
{{#set: molecular weight=951.992   }}
 +
{{#set: common name=L-thyroxine phenolic glucuronide|thyroxine glucuronide|beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-|T4G}}
 +
{{#set: produced by=RXN-10606}}

Latest revision as of 19:49, 21 March 2018

Metabolite CPD-11398

  • smiles:
    • C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
  • common name:
    • L-thyroxine phenolic β-D-glucuronide
  • inchi key:
    • InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M
  • molecular weight:
    • 951.992
  • Synonym(s):
    • L-thyroxine phenolic glucuronide
    • thyroxine glucuronide
    • beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-
    • T4G

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11398&oldid=44016"