Difference between revisions of "OCTADEC-9-ENE-118-DIOIC-ACID"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3781 PWY-3781] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3781 PWY-3781] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
 
* common name:
 
* common name:
−
** aerobic respiration I (cytochrome c)
+
** α,ω-9Z-octadecenedioate
 +
* inchi key:
 +
** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
 +
* molecular weight:
 +
** 310.433   
 
* Synonym(s):
 
* Synonym(s):
 +
** α,ω-9Z-octadecenedioic acid
 +
** 1,18-9Z-octadecenedioic acid
 +
** octadecenedioate
 +
** 18-carboxyl oleate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''4''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-16418]]
−
* [[1.10.2.2-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 5 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_18330]]
+
−
*** [[Tiso_gene_7235]]
+
−
*** [[Tiso_gene_15926]]
+
−
*** [[Tiso_gene_4973]]
+
−
*** [[Tiso_gene_9627]]
+
−
** 4 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[CYTOCHROME-C-OXIDASE-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Tiso_gene_18580]]
+
−
*** [[Tiso_gene_15682]]
+
−
*** [[Tiso_gene_7948]]
+
−
*** [[Tiso_gene_18053]]
+
−
** 4 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[NADH-DEHYDROG-A-RXN]]
+
−
** 18 associated gene(s):
+
−
*** [[Tiso_gene_10326]]
+
−
*** [[Tiso_gene_18831]]
+
−
*** [[Tiso_gene_4894]]
+
−
*** [[Tiso_gene_9874]]
+
−
*** [[Tiso_gene_18172]]
+
−
*** [[Tiso_gene_18339]]
+
−
*** [[Tiso_gene_19691]]
+
−
*** [[Tiso_gene_2949]]
+
−
*** [[Tiso_gene_4836]]
+
−
*** [[Tiso_gene_17199]]
+
−
*** [[Tiso_gene_5171]]
+
−
*** [[Tiso_gene_18707]]
+
−
*** [[Tiso_gene_359]]
+
−
*** [[Tiso_gene_3113]]
+
−
*** [[Tiso_gene_13075]]
+
−
*** [[Tiso_gene_355]]
+
−
*** [[Tiso_gene_358]]
+
−
*** [[Tiso_gene_15276]]
+
−
** 4 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[manual-primary_network]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
* ARACYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-3781 PWY-3781]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642]
−
{{#set: taxonomic range=TAX-2}}
+
{{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}}
−
{{#set: taxonomic range=TAX-2759}}
+
{{#set: common name=α,ω-9Z-octadecenedioate}}
−
{{#set: common name=aerobic respiration I (cytochrome c)}}
+
{{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}}
−
{{#set: reaction found=4}}
+
{{#set: molecular weight=310.433    }}
−
{{#set: total reaction=4}}
+
{{#set: common name=α,ω-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}}
−
{{#set: completion rate=100.0}}
+
{{#set: consumed by=RXN-16418}}

Latest revision as of 19:50, 21 March 2018

Metabolite OCTADEC-9-ENE-118-DIOIC-ACID

  • smiles:
    • C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
  • common name:
    • α,ω-9Z-octadecenedioate
  • inchi key:
    • InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
  • molecular weight:
    • 310.433
  • Synonym(s):
    • α,ω-9Z-octadecenedioic acid
    • 1,18-9Z-octadecenedioic acid
    • octadecenedioate
    • 18-carboxyl oleate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=OCTADEC-9-ENE-118-DIOIC-ACID&oldid=44045"