Difference between revisions of "PWY-6599"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == * smiles: ** C(=O)([O-])C1(C=C(N)C(O)=CC=1) * inchi key: ** InChIKey=MR...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6599 PWY-6599] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6599 PWY-6599] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** guanine and guanosine salvage II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''2''' reactions in the full pathway | |
− | + | * [[GUANPRIBOSYLTRAN-RXN]] | |
− | * [[ | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_13506]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN0-366]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_11910]] | ||
+ | *** [[Tiso_gene_12995]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=guanine and guanosine salvage II}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:27, 21 March 2018
Pathway PWY-6599
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- GUANPRIBOSYLTRAN-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN0-366
- 2 associated gene(s):
- 1 reconstruction source(s) associated: