Difference between revisions of "Tiso gene 20050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == * smiles: ** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Gene == Gene Tiso_gene_20050 == * Synonym(s): == Reactions associated == * Reaction: OROTPDECARB-RXN ** Source: orthology-synechocystis == Pathways assoc...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] ==
+
== Gene Tiso_gene_20050 ==
* smiles:
+
** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
* inchi key:
+
** InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J
+
* common name:
+
** (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA
+
* molecular weight:
+
** 1015.898   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-16559]]
+
* Reaction: [[OROTPDECARB-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-synechocystis]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7790]]
 +
* [[PWY-7791]]
 +
* [[PWY-5686]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=OROTPDECARB-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820456 91820456]
+
{{#set: pathway associated=PWY-7790|PWY-7791|PWY-5686}}
{{#set: smiles=CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: inchi key=InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J}}
+
{{#set: common name=(11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA}}
+
{{#set: molecular weight=1015.898    }}
+
{{#set: consumed by=RXN-16559}}
+

Latest revision as of 19:50, 21 March 2018

Gene Tiso_gene_20050

  • Synonym(s):

Reactions associated

Pathways associated

External links