Difference between revisions of "Protein-Red-Disulfides"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-] * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Red-Disulfides Protein-Red-Disulfides] == * common name: ** a protein with reduced sulf...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Red-Disulfides Protein-Red-Disulfides] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a protein with reduced sulfide groups |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a protein with reduced SH groups |
− | ** | + | ** protein with reduced SH groups |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[DISULFOXRED-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a protein with reduced sulfide groups}} | |
− | + | {{#set: common name=a protein with reduced SH groups|protein with reduced SH groups}} | |
− | + | {{#set: reversible reaction associated=DISULFOXRED-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:50, 21 March 2018
Contents
Metabolite Protein-Red-Disulfides
- common name:
- a protein with reduced sulfide groups
- Synonym(s):
- a protein with reduced SH groups
- protein with reduced SH groups