Difference between revisions of "GLYOXIII-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYOXIII-RXN GLYOXIII-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYOXIII-RXN GLYOXIII-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.2.1.130 EC-4.2.1.130] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[METHYL-GLYOXAL]][c] '''=>''' 1 [[D-LACTATE]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 H2O[c] '''+''' 1 methylglyoxal[c] '''=>''' 1 (R)-lactate[c] '''+''' 1 H+[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_19902]] |
− | == | + | ** Source: [[orthology-esiliculosus]] |
+ | * Gene: [[Tiso_gene_19117]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_12113]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_19118]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_19293]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_4228]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_10185]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27754 27754] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: ec number=EC-4.2.1.130}} |
− | + | {{#set: gene associated=Tiso_gene_19902|Tiso_gene_19117|Tiso_gene_12113|Tiso_gene_19118|Tiso_gene_19293|Tiso_gene_4228|Tiso_gene_10185}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:50, 21 March 2018
Contents
Reaction GLYOXIII-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 METHYL-GLYOXAL[c] => 1 D-LACTATE[c] + 1 PROTON[c]
- With common name(s):
- 1 H2O[c] + 1 methylglyoxal[c] => 1 (R)-lactate[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_19902
- Source: orthology-esiliculosus
- Gene: Tiso_gene_19117
- Source: orthology-esiliculosus
- Gene: Tiso_gene_12113
- Source: orthology-esiliculosus
- Gene: Tiso_gene_19118
- Source: orthology-esiliculosus
- Gene: Tiso_gene_19293
- Source: orthology-esiliculosus
- Gene: Tiso_gene_4228
- Source: orthology-esiliculosus
- Gene: Tiso_gene_10185
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- RHEA: