Difference between revisions of "CYSTEAMINE-DIOXYGENASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * inchi key: ** InChIKey=WX...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTEAMINE-DIOXYGENASE-RXN CYSTEAMINE-DIOXYGENASE-RXN] == * direction: ** LEFT-TO-RIGHT * common na...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTEAMINE-DIOXYGENASE-RXN CYSTEAMINE-DIOXYGENASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** 2-aminoethanethiol_dioxygenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.13.11.19 EC-1.13.11.19] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-239]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[HYPOTAURINE]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 oxygen[c] '''+''' 1 cysteamine[c] '''=>''' 1 H+[c] '''+''' 1 hypotaurine[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_9748]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5331]], taurine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5331 PWY-5331] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14409 14409] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02467 R02467] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | {{#set: | + | {{#set: common name=2-aminoethanethiol_dioxygenase}} |
− | {{#set: | + | {{#set: ec number=EC-1.13.11.19}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_9748}} |
− | {{#set: | + | {{#set: in pathway=PWY-5331}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} |
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:51, 21 March 2018
Contents
Reaction CYSTEAMINE-DIOXYGENASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 2-aminoethanethiol_dioxygenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OXYGEN-MOLECULE[c] + 1 CPD-239[c] => 1 PROTON[c] + 1 HYPOTAURINE[c]
- With common name(s):
- 1 oxygen[c] + 1 cysteamine[c] => 1 H+[c] + 1 hypotaurine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_9748
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links