Difference between revisions of "PHTYOSPHINGOSINE-1-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHTYOSPHINGOSINE-1-P PHTYOSPHINGOSINE-1-P] == * smiles: ** CCCCCCCCCCCCCCC(O)C(C(COP([O-])(=O)[...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHTYOSPHINGOSINE-1-P PHTYOSPHINGOSINE-1-P] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCCC(O)C(C(COP([O-])(=O)[O-])[N+])O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** phytosphingosine 1-phosphate |
| + | * inchi key: | ||
| + | ** InChIKey=AYGOSKULTISFCW-KSZLIROESA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 396.483 |
* Synonym(s): | * Synonym(s): | ||
| + | ** (2S,3S,4R)-2-ammonio-3,4-dihydroxyoctadecyl phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13729]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339286 57339286] |
| − | {{#set: smiles= | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64795 64795] |
| − | {{#set: | + | * HMDB : HMDB12280 |
| − | {{#set: molecular weight= | + | {{#set: smiles=CCCCCCCCCCCCCCC(O)C(C(COP([O-])(=O)[O-])[N+])O}} |
| − | {{#set: | + | {{#set: common name=phytosphingosine 1-phosphate}} |
| + | {{#set: inchi key=InChIKey=AYGOSKULTISFCW-KSZLIROESA-M}} | ||
| + | {{#set: molecular weight=396.483 }} | ||
| + | {{#set: common name=(2S,3S,4R)-2-ammonio-3,4-dihydroxyoctadecyl phosphate}} | ||
| + | {{#set: consumed by=RXN-13729}} | ||
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite PHTYOSPHINGOSINE-1-P
- smiles:
- CCCCCCCCCCCCCCC(O)C(C(COP([O-])(=O)[O-])[N+])O
- common name:
- phytosphingosine 1-phosphate
- inchi key:
- InChIKey=AYGOSKULTISFCW-KSZLIROESA-M
- molecular weight:
- 396.483
- Synonym(s):
- (2S,3S,4R)-2-ammonio-3,4-dihydroxyoctadecyl phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCCC(O)C(C(COP([O-])(=O)[O-])[N+])O" cannot be used as a page name in this wiki.
