Difference between revisions of "CPD-19158"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_17705 == * left end position: ** 1348 * transcription direction: ** POSITIVE * right end position: ** 3028 * centisome position: ** 38.3717...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == * smiles: ** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_17705 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] ==
* left end position:
+
* smiles:
** 1348
+
** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** 3-oxo-(9Z)-hexadecenoyl-CoA
* right end position:
+
* inchi key:
** 3028
+
** InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
* centisome position:
+
* molecular weight:
** 38.37176    
+
** 1013.883    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-16:1-Δ9-CoA
 +
** 3-oxo-9-cis-hexadecenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[HOMOSERKIN-RXN]]
+
* [[RXN-17791]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN-17790]]
** experimental_annotation
+
== Reaction(s) of unknown directionality ==
***ec-number
+
** [[pantograph]]-[[athaliana]]
+
** [[pantograph]]-[[synechocystis]]
+
** [[pantograph]]-[[esiliculosus]]
+
** [[pantograph]]-[[creinhardtii]]
+
== Pathways associated ==
+
* [[PWY-702]]
+
* [[HOMOSER-THRESYN-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1348}}
+
{{#set: smiles=CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: transcription direction=POSITIVE}}
+
{{#set: common name=3-oxo-(9Z)-hexadecenoyl-CoA}}
{{#set: right end position=3028}}
+
{{#set: inchi key=InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J}}
{{#set: centisome position=38.37176   }}
+
{{#set: molecular weight=1013.883   }}
{{#set: reaction associated=HOMOSERKIN-RXN}}
+
{{#set: common name=3-oxo-16:1-Δ9-CoA|3-oxo-9-cis-hexadecenoyl-CoA}}
{{#set: pathway associated=PWY-702|HOMOSER-THRESYN-PWY}}
+
{{#set: consumed by=RXN-17791}}
 +
{{#set: produced by=RXN-17790}}

Latest revision as of 19:51, 21 March 2018

Metabolite CPD-19158

  • smiles:
    • CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 3-oxo-(9Z)-hexadecenoyl-CoA
  • inchi key:
    • InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
  • molecular weight:
    • 1013.883
  • Synonym(s):
    • 3-oxo-16:1-Δ9-CoA
    • 3-oxo-9-cis-hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.