Difference between revisions of "CPD-14927"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5508 PWY-5508] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * common name: ** ph...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5508 PWY-5508] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
 
* common name:
 
* common name:
−
** adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II
+
** phytenate
 +
* inchi key:
 +
** InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M
 +
* molecular weight:
 +
** 309.511   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2E-phytenate
 +
** 2E-phytenic acid
 +
** 3,7,11,15-tetramethyl-2E-hexadecenoic acid
 +
** (E)-3,7,11,15-tetramethylhexadec-2-enoic acid
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''3''' reaction(s) found
+
* [[RXN66-480]]
−
** [[COBALAMINSYN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** [[R344-RXN]]
+
* [[RXN66-479]]
−
** [[RIBAZOLEPHOSPHAT-RXN]]
+
== Reaction(s) of unknown directionality ==
−
== Reaction(s) not found ==
+
−
* '''6''' reaction(s) not found
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=COBINPGUANYLYLTRANS-RXN COBINPGUANYLYLTRANS-RXN]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=R343-RXN R343-RXN]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=R345-RXN R345-RXN]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-6261 RXN-6261]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=DMBPPRIBOSYLTRANS-RXN DMBPPRIBOSYLTRANS-RXN]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8771 RXN-8771]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2}}
+
* LIPID_MAPS : LMPR0104010024
−
{{#set: taxonomic range=TAX-2157}}
+
* PUBCHEM:
−
{{#set: common name=adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40561589 40561589]
−
{{#set: reaction found=3}}
+
* CHEMSPIDER:
−
{{#set: reaction not found=6}}
+
** [http://www.chemspider.com/Chemical-Structure.4471755.html 4471755]
 +
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]}}
 +
{{#set: common name=phytenate}}
 +
{{#set: inchi key=InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M}}
 +
{{#set: molecular weight=309.511    }}
 +
{{#set: common name=2E-phytenate|2E-phytenic acid|3,7,11,15-tetramethyl-2E-hexadecenoic acid|(E)-3,7,11,15-tetramethylhexadec-2-enoic acid}}
 +
{{#set: consumed by=RXN66-480}}
 +
{{#set: produced by=RXN66-479}}

Latest revision as of 19:28, 21 March 2018

Metabolite CPD-14927

  • smiles:
    • CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]
  • common name:
    • phytenate
  • inchi key:
    • InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M
  • molecular weight:
    • 309.511
  • Synonym(s):
    • 2E-phytenate
    • 2E-phytenic acid
    • 3,7,11,15-tetramethyl-2E-hexadecenoic acid
    • (E)-3,7,11,15-tetramethylhexadec-2-enoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-14927&oldid=41777"