Difference between revisions of "Tiso gene 11612"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == * smiles: ** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=L...")
(Created page with "Category:Gene == Gene Tiso_gene_11612 == * right end position: ** 2180 * transcription direction: ** POSITIVE * left end position: ** 47 * centisome position: ** 0.6122981...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] ==
+
== Gene Tiso_gene_11612 ==
−
* smiles:
+
* right end position:
−
** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
+
** 2180
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-(6'-methylthio)hexylmalate
+
** 47
−
* molecular weight:
+
* centisome position:
−
** 262.32    
+
** 0.6122981    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-(6'-methylthio)hexylmalic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXNQT-4174]]
+
* Reaction: [[3.1.13.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[RXN-18202]]
+
* Reaction: [[RXN0-4222]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-6479]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-6524]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-6525]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY0-1479]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2180}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237339 44237339]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
+
{{#set: left end position=47}}
−
{{#set: inchi key=InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L}}
+
{{#set: centisome position=0.6122981   }}
−
{{#set: common name=3-(6'-methylthio)hexylmalate}}
+
{{#set: reaction associated=3.1.13.1-RXN|RXN0-4222|RXN0-6479|RXN0-6524|RXN0-6525}}
−
{{#set: molecular weight=262.32   }}
+
{{#set: pathway associated=PWY0-1479}}
−
{{#set: common name=3-(6'-methylthio)hexylmalic acid}}
+
−
{{#set: consumed by=RXNQT-4174}}
+
−
{{#set: reversible reaction associated=RXN-18202}}
+

Latest revision as of 19:51, 21 March 2018

Gene Tiso_gene_11612

  • right end position:
    • 2180
  • transcription direction:
    • POSITIVE
  • left end position:
    • 47
  • centisome position:
    • 0.6122981
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11612&oldid=44234"