Difference between revisions of "RXN-16020"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == * smiles: ** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O) * inchi key: ** InChIKey=JT...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16020 RXN-16020] == * direction: ** LEFT-TO-RIGHT * common name: ** chloroplast_beta-keto_acyl_...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16020 RXN-16020] ==
−
* smiles:
+
* direction:
−
** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JTFITTQBRJDSTL-KVTDHHQDSA-L
+
 
* common name:
 
* common name:
−
** S-methyl-5-thio-α-D-ribose 1-phosphate
+
** chloroplast_beta-keto_acyl_reductase
−
* molecular weight:
+
* ec number:
−
** 258.182   
+
** [http://enzyme.expasy.org/EC/1.1.1.330 EC-1.1.1.330]
 
* Synonym(s):
 
* Synonym(s):
−
** 5-methylthioribose-1-phosphate
 
−
** S5-methyl-5-thio-D-ribose-1-phosphate
 
−
** 5-methylthio-D-ribose-1-phosphate
 
−
** 5-MTR-1-P
 
−
** 1-phosphomethylthioribose
 
−
** 1-phospho-5-S-methylthioribose
 
−
** 1-PMTR
 
−
** 1-phospho-5-S-methylthio-α-D-ribofuranoside
 
−
** S-methyl-5-thio-α-D-ribose 1-phosphate
 
−
** S-methyl-5-thio-D-ribose 1-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[M5TRPI]]
+
* With identifiers:
−
* [[5.3.1.23-RXN]]
+
** 1 [[PROTON]][c] '''+''' 1 [[CPD-17262]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''=>''' 1 [[CPD-17263]][c] '''+''' 1 [[NAD-P-OR-NOP]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[M5TAP]]
+
** 1 H+[c] '''+''' 1 3-oxo-icosatetraenoyl-CoA[c] '''+''' 1 NAD(P)H[c] '''=>''' 1 (8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA[c] '''+''' 1 NAD(P)+[c]
−
* [[M5TRK]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9871]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7049]], icosapentaenoate biosynthesis II (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7049 PWY-7049]
 +
** '''2''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-6958]], icosapentaenoate biosynthesis I (lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6958 PWY-6958]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 5mdr1p
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=chloroplast_beta-keto_acyl_reductase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266677 45266677]
+
{{#set: ec number=EC-1.1.1.330}}
−
* HMDB : HMDB00963
+
{{#set: gene associated=Tiso_gene_9871}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7049|PWY-6958}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04188 C04188]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58533 58533]
+
{{#set: reconstruction tool=pathwaytools}}
−
* METABOLIGHTS : MTBLC58533
+
−
{{#set: smiles=CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O)}}
+
−
{{#set: inchi key=InChIKey=JTFITTQBRJDSTL-KVTDHHQDSA-L}}
+
−
{{#set: common name=S-methyl-5-thio-α-D-ribose 1-phosphate}}
+
−
{{#set: molecular weight=258.182    }}
+
−
{{#set: common name=5-methylthioribose-1-phosphate|S5-methyl-5-thio-D-ribose-1-phosphate|5-methylthio-D-ribose-1-phosphate|5-MTR-1-P|1-phosphomethylthioribose|1-phospho-5-S-methylthioribose|1-PMTR|1-phospho-5-S-methylthio-α-D-ribofuranoside|S-methyl-5-thio-α-D-ribose 1-phosphate|S-methyl-5-thio-D-ribose 1-phosphate}}
+
−
{{#set: consumed by=M5TRPI|5.3.1.23-RXN}}
+
−
{{#set: produced by=M5TAP|M5TRK}}
+

Latest revision as of 19:51, 21 March 2018

Reaction RXN-16020

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • chloroplast_beta-keto_acyl_reductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H+[c] + 1 3-oxo-icosatetraenoyl-CoA[c] + 1 NAD(P)H[c] => 1 (8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA[c] + 1 NAD(P)+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7049, icosapentaenoate biosynthesis II (6-desaturase, mammals): PWY-7049
    • 2 reactions found over 7 reactions in the full pathway
  • PWY-6958, icosapentaenoate biosynthesis I (lower eukaryotes): PWY-6958
    • 2 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16020&oldid=44247"