Difference between revisions of "Tiso gene 348"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_348 == * right end position: ** 34578 * transcription direction: ** POSITIVE * left end position: ** 30916 * centisome position: ** 87.8994...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] ==
+
== Gene Tiso_gene_348 ==
* smiles:
+
* right end position:
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** 34578
* inchi key:
+
* transcription direction:
** InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
+
** POSITIVE
* common name:
+
* left end position:
** gibberellin A12
+
** 30916
* molecular weight:
+
* centisome position:
** 330.423    
+
** 87.89947    
 
* Synonym(s):
 
* Synonym(s):
** C20-GAs
 
** open lactone gibberrellin skeleton
 
** C20 skeleton
 
** C20-GA skeleton
 
** C20-gibberellin skeleton
 
** GA12
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN1F-162]]
+
* Reaction: [[ACYLCOASYN-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN1F-161]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[LINOLENOYL-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[R223-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12184]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12978]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13290]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13614]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16380]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16389]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16393]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16401]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16402]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16415]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16418]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-7904]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9623]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN-9644]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9673]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-7238]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-7239]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-7248]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-469]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-477]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-480]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-483]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-484]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[TRANS-RXN0-623]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6920]]
 +
* [[P221-PWY]]
 +
* [[PWY-321]]
 +
* [[PWY-5972]]
 +
* [[PWY-5971]]
 +
* [[PWY-7033]]
 +
* [[PWY-5136]]
 +
* [[PWY66-389]]
 +
* [[PWY-7288]]
 +
* [[PWY-6733]]
 +
* [[PWY-7094]]
 +
* [[PWY66-391]]
 +
* [[FAO-PWY]]
 +
* [[PWY-1121]]
 +
* [[PWY-6873]]
 +
* [[PWY-5147]]
 +
* [[PWY-5143]]
 +
* [[PWY-5885]]
 +
* [[PWY-7724]]
 +
* [[PWY-6001]]
 +
* [[PWY-6000]]
 +
* [[PWY-7049]]
 +
* [[PWY66-387]]
 +
* [[PWY-5989]]
 +
* [[PWY-6803]]
 +
* [[PWY66-388]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170014
+
{{#set: right end position=34578}}
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244528 25244528]
+
{{#set: left end position=30916}}
* CHEBI:
+
{{#set: centisome position=87.89947   }}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58627 58627]
+
{{#set: reaction associated=ACYLCOASYN-RXN|LINOLENOYL-RXN|R223-RXN|RXN-12184|RXN-12978|RXN-13290|RXN-13614|RXN-16380|RXN-16389|RXN-16393|RXN-16401|RXN-16402|RXN-16415|RXN-16418|RXN-7904|RXN-9623|RXN-9644|RXN-9673|RXN0-7238|RXN0-7239|RXN0-7248|RXN66-469|RXN66-477|RXN66-480|RXN66-483|RXN66-484|TRANS-RXN0-623}}
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6920|P221-PWY|PWY-321|PWY-5972|PWY-5971|PWY-7033|PWY-5136|PWY66-389|PWY-7288|PWY-6733|PWY-7094|PWY66-391|FAO-PWY|PWY-1121|PWY-6873|PWY-5147|PWY-5143|PWY-5885|PWY-7724|PWY-6001|PWY-6000|PWY-7049|PWY66-387|PWY-5989|PWY-6803|PWY66-388}}
** [http://www.genome.jp/dbget-bin/www_bget?C11857 C11857]
+
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L}}
+
{{#set: common name=gibberellin A12}}
+
{{#set: molecular weight=330.423   }}
+
{{#set: common name=C20-GAs|open lactone gibberrellin skeleton|C20 skeleton|C20-GA skeleton|C20-gibberellin skeleton|GA12}}
+
{{#set: consumed by=RXN1F-162}}
+
{{#set: produced by=RXN1F-161}}
+

Latest revision as of 19:06, 21 March 2018

Gene Tiso_gene_348

  • right end position:
    • 34578
  • transcription direction:
    • POSITIVE
  • left end position:
    • 30916
  • centisome position:
    • 87.89947
  • Synonym(s):

Reactions associated

Pathways associated

External links