Difference between revisions of "Tiso gene 3775"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * inchi key: ** InChIKey=QIVB...") |
(Created page with "Category:Gene == Gene Tiso_gene_3775 == * right end position: ** 7832 * transcription direction: ** NEGATIVE * left end position: ** 5801 * centisome position: ** 36.10730...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3775 == |
− | * | + | * right end position: |
− | ** | + | ** 7832 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 5801 |
− | * | + | * centisome position: |
− | ** | + | ** 36.107307 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GALPMUT-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | ** Source: [[annotation-experimental_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY-6397]] |
− | + | * [[OANTIGEN-PWY]] | |
+ | * [[PWY-7328]] | ||
+ | * [[PWY-7622]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=7832}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=5801}} | |
− | + | {{#set: centisome position=36.107307 }} | |
− | + | {{#set: reaction associated=GALPMUT-RXN}} | |
− | + | {{#set: pathway associated=PWY-6397|OANTIGEN-PWY|PWY-7328|PWY-7622}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:28, 21 March 2018
Gene Tiso_gene_3775
- right end position:
- 7832
- transcription direction:
- NEGATIVE
- left end position:
- 5801
- centisome position:
- 36.107307
- Synonym(s):
Reactions associated
- Reaction: GALPMUT-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation