|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ORNCARBAMTRANSFER-RXN ORNCARBAMTRANSFER-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-ETHANOLAMINE PHOSPHORYL-ETHANOLAMINE] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C(C[N+])OP([O-])([O-])=O |
− | * ec number: | + | * common name: |
− | ** [http://enzyme.expasy.org/EC/2.1.3.3 EC-2.1.3.3] | + | ** O-phosphoethanolamine |
| + | * inchi key: |
| + | ** InChIKey=SUHOOTKUPISOBE-UHFFFAOYSA-M |
| + | * molecular weight: |
| + | ** 140.055 |
| * Synonym(s): | | * Synonym(s): |
| + | ** phosphoryl-ethanolamine |
| + | ** O-phosphorylethanolamine |
| + | ** phosphoethanolamine |
| + | ** ethanolamine phosphate |
| + | ** 2-aminoethyl phosphate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers: | + | * [[2.7.7.14-RXN]] |
− | ** 1 [[L-ORNITHINE]][c] '''+''' 1 [[CARBAMOYL-P]][c] '''<=>''' 1 [[Pi]][c] '''+''' 1 [[L-CITRULLINE]][c] '''+''' 1 [[PROTON]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN]] |
− | ** 1 L-ornithine[c] '''+''' 1 carbamoyl phosphate[c] '''<=>''' 1 phosphate[c] '''+''' 1 L-citrulline[c] '''+''' 1 H+[c]
| + | * [[SGPL11]] |
− | | + | * [[RXN3DJ-11230]] |
− | == Genes associated with this reaction == | + | * [[RXN-13729]] |
− | Genes have been associated with this reaction based on different elements listed below.
| + | * [[ETHANOLAMINE-KINASE-RXN]] |
− | * [[Tiso_gene_18444]] | + | == Reaction(s) of unknown directionality == |
− | ** EXPERIMENTAL_ANNOTATION
| + | * [[ETHANOLAMINE-PHOSPHATE-PHOSPHO-LYASE-RXN]] |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | == Pathways == | + | |
− | * [[ARGSYN-PWY]], L-arginine biosynthesis I (via L-ornithine): [http://metacyc.org/META/NEW-IMAGE?object=ARGSYN-PWY ARGSYN-PWY]
| + | |
− | ** '''5''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-4984]], urea cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4984 PWY-4984]
| + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[ARGSYNBSUB-PWY]], L-arginine biosynthesis II (acetyl cycle): [http://metacyc.org/META/NEW-IMAGE?object=ARGSYNBSUB-PWY ARGSYNBSUB-PWY] | + | |
− | ** '''9''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-4981]], L-proline biosynthesis II (from arginine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4981 PWY-4981]
| + | |
− | ** '''4''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-7400]], L-arginine biosynthesis IV (archaebacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7400 PWY-7400]
| + | |
− | ** '''7''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[CITRULLINE-DEG-PWY]], L-citrulline degradation: [http://metacyc.org/META/NEW-IMAGE?object=CITRULLINE-DEG-PWY CITRULLINE-DEG-PWY]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[CITRULBIO-PWY]], L-citrulline biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=CITRULBIO-PWY CITRULBIO-PWY]
| + | |
− | ** '''8''' reactions found over '''8''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-synechocystis]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[manual]]
| + | |
− | ** Source: [[manual-primary_network]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 1071-23-4 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19513 19513] | + | * PUBCHEM: |
− | * LIGAND-RXN: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7059434 7059434] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01398 R01398] | + | * HMDB : HMDB00224 |
− | * UNIPROT: | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/Q58291 Q58291] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00346 C00346] |
− | ** [http://www.uniprot.org/uniprot/Q9CHD1 Q9CHD1]
| + | * CHEMSPIDER: |
− | ** [http://www.uniprot.org/uniprot/Q7M182 Q7M182] | + | ** [http://www.chemspider.com/Chemical-Structure.5415641.html 5415641] |
− | ** [http://www.uniprot.org/uniprot/Q9JTI4 Q9JTI4] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P11727 P11727]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58190 58190] |
− | ** [http://www.uniprot.org/uniprot/Q9CEY4 Q9CEY4]
| + | * METABOLIGHTS : MTBLC58190 |
− | ** [http://www.uniprot.org/uniprot/Q9CE14 Q9CE14] | + | {{#set: smiles=C(C[N+])OP([O-])([O-])=O}} |
− | ** [http://www.uniprot.org/uniprot/Q9PNU6 Q9PNU6]
| + | {{#set: common name=O-phosphoethanolamine}} |
− | ** [http://www.uniprot.org/uniprot/P44770 P44770]
| + | {{#set: inchi key=InChIKey=SUHOOTKUPISOBE-UHFFFAOYSA-M}} |
− | ** [http://www.uniprot.org/uniprot/Q9YHY9 Q9YHY9]
| + | {{#set: molecular weight=140.055 }} |
− | ** [http://www.uniprot.org/uniprot/P11066 P11066]
| + | {{#set: common name=phosphoryl-ethanolamine|O-phosphorylethanolamine|phosphoethanolamine|ethanolamine phosphate|2-aminoethyl phosphate}} |
− | ** [http://www.uniprot.org/uniprot/P11803 P11803]
| + | {{#set: consumed by=2.7.7.14-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P18186 P18186]
| + | {{#set: produced by=SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN|SGPL11|RXN3DJ-11230|RXN-13729|ETHANOLAMINE-KINASE-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P05150 P05150]
| + | {{#set: reversible reaction associated=ETHANOLAMINE-PHOSPHATE-PHOSPHO-LYASE-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P14995 P14995]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06960 P06960]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04391 P04391]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00480 P00480]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11725 P11725]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21302 P21302]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11724 P11724]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08308 P08308]
| + | |
− | ** [http://www.uniprot.org/uniprot/P68747 P68747]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00481 P00481]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31317 P31317]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01322 Q01322]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01323 Q01323]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01324 Q01324]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01326 Q01326]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01325 Q01325]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JYI3 Q9JYI3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01327 Q01327]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A5M9 P0A5M9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02047 Q02047]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9TRC9 Q9TRC9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q48296 Q48296]
| + | |
− | ** [http://www.uniprot.org/uniprot/P75473 P75473]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49080 Q49080]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43814 Q43814]
| + | |
− | ** [http://www.uniprot.org/uniprot/O53089 O53089]
| + | |
− | ** [http://www.uniprot.org/uniprot/O50039 O50039]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: ec number=EC-2.1.3.3}} | + | |
− | {{#set: gene associated=Tiso_gene_18444}} | + | |
− | {{#set: in pathway=ARGSYN-PWY|PWY-4984|ARGSYNBSUB-PWY|PWY-4981|PWY-7400|CITRULLINE-DEG-PWY|CITRULBIO-PWY}} | + | |
− | {{#set: reconstruction category=orthology|manual|annotation}} | + | |
− | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network|orthology-creinhardtii}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}} | + | |