Difference between revisions of "Tiso gene 6189"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * inchi key: ** InChIKey=ZBCBET...") |
(Created page with "Category:Gene == Gene Tiso_gene_6189 == * right end position: ** 5198 * transcription direction: ** POSITIVE * left end position: ** 4365 * centisome position: ** 35.04616...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6189 == |
− | * | + | * right end position: |
− | ** | + | ** 5198 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 4365 |
− | * | + | * centisome position: |
− | ** | + | ** 35.046165 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[CYTOCHROME-B5-REDUCTASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-11195]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5198}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=4365}} | |
− | + | {{#set: centisome position=35.046165 }} | |
− | + | {{#set: reaction associated=CYTOCHROME-B5-REDUCTASE-RXN|RXN-11195}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:52, 21 March 2018
Gene Tiso_gene_6189
- right end position:
- 5198
- transcription direction:
- POSITIVE
- left end position:
- 4365
- centisome position:
- 35.046165
- Synonym(s):
Reactions associated
- Reaction: CYTOCHROME-B5-REDUCTASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-11195
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation