Difference between revisions of "Amino-Acids-20"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * smiles: ** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3))) * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Amino-Acids-20 Amino-Acids-20] == * common name: ** a proteinogenic amino acid * Synonym(s): **...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Amino-Acids-20 Amino-Acids-20] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a proteinogenic amino acid |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a protein-building amino acid |
+ | ** a standard α amino acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-6601]] |
+ | * [[RXN66-336]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3.4.11.9-RXN]] | ||
+ | * [[3.4.16.5-RXN]] | ||
+ | * [[3.4.11.14-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a proteinogenic amino acid}} | |
− | + | {{#set: common name=a protein-building amino acid|a standard α amino acid}} | |
− | + | {{#set: consumed by=RXN-6601|RXN66-336}} | |
− | + | {{#set: produced by=3.4.11.9-RXN|3.4.16.5-RXN|3.4.11.14-RXN}} | |
− | + | {{#set: reversible reaction associated=ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite Amino-Acids-20
- common name:
- a proteinogenic amino acid
- Synonym(s):
- a protein-building amino acid
- a standard α amino acid