Difference between revisions of "CPD-431"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8579 CPD-8579] == * common name: ** a [histone] N6-methyl-L-lysine * Synonym(s): == Reacti...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * smiles: ** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3))) * common...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == |
+ | * smiles: | ||
+ | ** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3))) | ||
* common name: | * common name: | ||
− | ** | + | ** apigenin |
+ | * inchi key: | ||
+ | ** InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M | ||
+ | * molecular weight: | ||
+ | ** 269.233 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 4',5,7-trihydroxyflavone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7651]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 520-36-5 |
− | {{#set: | + | * LIPID_MAPS : LMPK12110005 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200950 25200950] | ||
+ | * HMDB : HMDB02124 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01477 C01477] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58470 58470] | ||
+ | {{#set: smiles=C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))}} | ||
+ | {{#set: common name=apigenin}} | ||
+ | {{#set: inchi key=InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=269.233 }} | ||
+ | {{#set: common name=4',5,7-trihydroxyflavone}} | ||
+ | {{#set: consumed by=RXN-7651}} |
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite CPD-431
- smiles:
- C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))
- common name:
- apigenin
- inchi key:
- InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M
- molecular weight:
- 269.233
- Synonym(s):
- 4',5,7-trihydroxyflavone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 520-36-5
- LIPID_MAPS : LMPK12110005
- PUBCHEM:
- HMDB : HMDB02124
- LIGAND-CPD:
- CHEBI:
"C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))" cannot be used as a page name in this wiki.