Difference between revisions of "MPBQ"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14966 == * left end position: ** 126 * transcription direction: ** POSITIVE * right end position: ** 5001 * centisome position: ** 2.367976...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C * common name: *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C |
| − | * | + | * common name: |
| − | ** | + | ** 2-methyl-6-phytyl-1,4-benzoquinol |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 402.659 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-2542]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-2541]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15882 C15882] |
| − | {{#set: | + | * HMDB : HMDB38959 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75920 75920] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC75920 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768135 71768135] | ||
| + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C}} | ||
| + | {{#set: common name=2-methyl-6-phytyl-1,4-benzoquinol}} | ||
| + | {{#set: inchi key=InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N}} | ||
| + | {{#set: molecular weight=402.659 }} | ||
| + | {{#set: consumed by=RXN-2542}} | ||
| + | {{#set: produced by=RXN-2541}} | ||
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite MPBQ
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C
- common name:
- 2-methyl-6-phytyl-1,4-benzoquinol
- inchi key:
- InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N
- molecular weight:
- 402.659
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
