Difference between revisions of "CPD-1834"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] == * smiles: ** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] == |
* smiles: | * smiles: | ||
| − | ** CC( | + | ** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4)))) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (25R)-3α,7α-dihydroxy-5-β-cholestanate |
| + | * inchi key: | ||
| + | ** InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 433.65 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-α,7-α-dihydroxy-5-β-cholestanoate |
| + | ** 3-α,7-α-dihydroxy-5-β-cholestanate | ||
| + | ** (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9844]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266753 45266753] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58750 58750] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04554 C04554] |
| − | {{#set: smiles=CC( | + | {{#set: smiles=CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))}} |
| − | {{#set: | + | {{#set: common name=(25R)-3α,7α-dihydroxy-5-β-cholestanate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=433.65 }} |
| − | {{#set: common name= | + | {{#set: common name=3-α,7-α-dihydroxy-5-β-cholestanoate|3-α,7-α-dihydroxy-5-β-cholestanate|(25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate}} |
| − | {{#set: | + | {{#set: produced by=RXN-9844}} |
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite CPD-1834
- smiles:
- CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
- common name:
- (25R)-3α,7α-dihydroxy-5-β-cholestanate
- inchi key:
- InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M
- molecular weight:
- 433.65
- Synonym(s):
- 3-α,7-α-dihydroxy-5-β-cholestanoate
- 3-α,7-α-dihydroxy-5-β-cholestanate
- (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))" cannot be used as a page name in this wiki.
