Difference between revisions of "RXNQT-4171"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4171 RXNQT-4171] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-isopropylmalate dehydro...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4171 RXNQT-4171] ==
−
* smiles:
+
* direction:
−
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N
+
 
* common name:
 
* common name:
−
** 24-methylenelophenol
+
** 3-isopropylmalate dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 412.698   
+
** [http://enzyme.expasy.org/EC/1.1.1.85 EC-1.1.1.85]
 
* Synonym(s):
 
* Synonym(s):
−
** 4α-methyl-5α-ergosta-7,24-dien-3β-ol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2.1.1.143-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPDQT-38]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[CPDQT-29]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[NADH]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 3-(5'-methylthio)pentylmalate[c] '''+''' 1 NAD+[c] '''=>''' 1 8-(methylthio)-2-oxooctanoate[c] '''+''' 1 CO2[c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2920]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283640 5283640]
+
** [http://www.genome.jp/dbget-bin/www_bget?R08636 R08636]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29107 29107]
+
{{#set: common name=3-isopropylmalate dehydrogenase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.1.1.85}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11522 C11522]
+
{{#set: gene associated=Tiso_gene_2920}}
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=24-methylenelophenol}}
+
{{#set: reconstruction source=annotation-experimental_annotation}}
−
{{#set: molecular weight=412.698    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=4α-methyl-5α-ergosta-7,24-dien-3β-ol}}
+
−
{{#set: consumed by=2.1.1.143-RXN}}
+

Latest revision as of 19:53, 21 March 2018

Reaction RXNQT-4171

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-isopropylmalate dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3-(5'-methylthio)pentylmalate[c] + 1 NAD+[c] => 1 8-(methylthio)-2-oxooctanoate[c] + 1 CO2[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXNQT-4171&oldid=44440"