Difference between revisions of "Tiso gene 6822"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...")
(Created page with "Category:Gene == Gene Tiso_gene_6822 == * Synonym(s): == Reactions associated == * Reaction: ATPASE-RXN ** Source: annotation-in-silico_annotation *** Assignment:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] ==
+
== Gene Tiso_gene_6822 ==
* smiles:
+
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
+
* inchi key:
+
** InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N
+
* common name:
+
** ubiquinol-8
+
* molecular weight:
+
** 729.137   
+
 
* Synonym(s):
 
* Synonym(s):
** ubiquinol(8)
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
* [[DHHB-METHYLTRANSFER-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
* [[NADHor_2m]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=ATPASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25074411 25074411]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61682 61682]
+
* BIGG : q8h2
+
* HMDB : HMDB01060
+
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}}
+
{{#set: inchi key=InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N}}
+
{{#set: common name=ubiquinol-8}}
+
{{#set: molecular weight=729.137    }}
+
{{#set: common name=ubiquinol(8)}}
+
{{#set: produced by=DHHB-METHYLTRANSFER-RXN|NADHor_2m}}
+

Latest revision as of 19:54, 21 March 2018

Gene Tiso_gene_6822

  • Synonym(s):

Reactions associated

Pathways associated

External links