Difference between revisions of "SINAPOYL-COA"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1810 == * Synonym(s): == Reactions associated == * 2.7.10.1-RXN ** in-silico_annotation ***ec-number * 2.7.12.1-RXN ** in-silico_a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == |
+ | * smiles: | ||
+ | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] | ||
+ | * common name: | ||
+ | ** sinapoyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J | ||
+ | * molecular weight: | ||
+ | ** 969.7 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** sinapinoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10919]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-1124]] | |
− | + | ||
− | + | ||
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229225 44229225] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57393 57393] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00411 C00411] | ||
+ | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
+ | {{#set: common name=sinapoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J}} | ||
+ | {{#set: molecular weight=969.7 }} | ||
+ | {{#set: common name=sinapinoyl-CoA}} | ||
+ | {{#set: produced by=RXN-10919}} | ||
+ | {{#set: reversible reaction associated=RXN-1124}} |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite SINAPOYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- common name:
- sinapoyl-CoA
- inchi key:
- InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J
- molecular weight:
- 969.7
- Synonym(s):
- sinapinoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.