Difference between revisions of "CPD-490"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2354 CPD0-2354] == * common name: ** a tRNA precursor with a 5' extension * Synonym(s): =...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] == * smiles: ** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O * common name: ** α-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2354 CPD0-2354] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] ==
 +
* smiles:
 +
** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O
 
* common name:
 
* common name:
** a tRNA precursor with a 5' extension
+
** α-D-xylose 1-phosphate
 +
* inchi key:
 +
** InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6480]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-4222]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.7.7.11-RXN]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a tRNA precursor with a 5' extension}}
+
* PUBCHEM:
{{#set: consumed by=RXN0-6480}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202995 25202995]
{{#set: produced by=RXN0-4222}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57559 57559]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03737 C03737]
 +
{{#set: smiles=C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O}}
 +
{{#set: common name=α-D-xylose 1-phosphate}}
 +
{{#set: inchi key=InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L}}
 +
{{#set: molecular weight=228.095    }}
 +
{{#set: reversible reaction associated=2.7.7.11-RXN}}

Latest revision as of 20:54, 21 March 2018

Metabolite CPD-490

  • smiles:
    • C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O
  • common name:
    • α-D-xylose 1-phosphate
  • inchi key:
    • InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L
  • molecular weight:
    • 228.095
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O" cannot be used as a page name in this wiki.