Difference between revisions of "Tiso gene 6106"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * smiles: ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Tiso_gene_6106 == * right end position: ** 2128 * transcription direction: ** NEGATIVE * left end position: ** 185 * centisome position: ** 1.287942...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6106 == |
− | * | + | * right end position: |
− | ** | + | ** 2128 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 185 |
− | * | + | * centisome position: |
− | ** | + | ** 1.287942 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PNKIN-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[RXN- | + | ** Source: [[orthology-athaliana]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | == | + | * Reaction: [[PYRAMKIN-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[PYRIDOXKIN-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7204]] | ||
+ | * [[PWY-7282]] | ||
+ | * [[PLPSAL-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2128}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=185}} | |
− | + | {{#set: centisome position=1.287942 }} | |
− | + | {{#set: reaction associated=PNKIN-RXN|PYRAMKIN-RXN|PYRIDOXKIN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7204|PWY-7282|PLPSAL-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:54, 21 March 2018
Gene Tiso_gene_6106
- right end position:
- 2128
- transcription direction:
- NEGATIVE
- left end position:
- 185
- centisome position:
- 1.287942
- Synonym(s):
Reactions associated
- Reaction: PNKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: PYRAMKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: PYRIDOXKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation