Difference between revisions of "DI-H-OROTATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14281 CPD-14281] == * smiles: ** CCCCCCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * smiles: ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) * common name: ** (S)-...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (S)-dihydroorotate |
+ | * inchi key: | ||
+ | ** InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 157.105 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** dihydro-L-orotate |
− | ** ( | + | ** (S)-4,5-dihydroorotate |
+ | ** (S)-4,5-dihydroorotic acid | ||
+ | ** (S)-hydroorotic acid | ||
+ | ** (S)-di-H-orotate | ||
+ | ** L-dihydroorotate | ||
+ | ** 4,5-dihydro-L-orotate | ||
+ | ** L-4,5-dihydroorotate | ||
+ | ** (S)-4-pyrimidinecarboxylic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN0-6491]] |
+ | * [[RXN0-6554]] | ||
+ | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] | ||
+ | * [[RXN-9929]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-6490]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[DIHYDROOROT-RXN]] | ||
== External links == | == External links == | ||
+ | * CAS : 5988-19-2 | ||
+ | * CAS : 155-54-4 | ||
+ | * BIGG : dhor__S | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460289 5460289] |
+ | * HMDB : HMDB00528 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00337 C00337] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573876.html 4573876] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30864 30864] |
− | {{#set: smiles= | + | * METABOLIGHTS : MTBLC30864 |
− | {{#set: | + | {{#set: smiles=C1(C(=O)NC(=O)NC(C(=O)[O-])1)}} |
− | {{#set: | + | {{#set: common name=(S)-dihydroorotate}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M}} |
− | {{#set: common name= | + | {{#set: molecular weight=157.105 }} |
− | {{#set: consumed by=RXN- | + | {{#set: common name=dihydro-L-orotate|(S)-4,5-dihydroorotate|(S)-4,5-dihydroorotic acid|(S)-hydroorotic acid|(S)-di-H-orotate|L-dihydroorotate|4,5-dihydro-L-orotate|L-4,5-dihydroorotate|(S)-4-pyrimidinecarboxylic acid}} |
− | {{#set: produced by= | + | {{#set: consumed by=RXN0-6491|RXN0-6554|DIHYDROOROTATE-DEHYDROGENASE-RXN|RXN-9929}} |
+ | {{#set: produced by=RXN0-6490}} | ||
+ | {{#set: reversible reaction associated=DIHYDROOROT-RXN}} |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite DI-H-OROTATE
- smiles:
- C1(C(=O)NC(=O)NC(C(=O)[O-])1)
- common name:
- (S)-dihydroorotate
- inchi key:
- InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M
- molecular weight:
- 157.105
- Synonym(s):
- dihydro-L-orotate
- (S)-4,5-dihydroorotate
- (S)-4,5-dihydroorotic acid
- (S)-hydroorotic acid
- (S)-di-H-orotate
- L-dihydroorotate
- 4,5-dihydro-L-orotate
- L-4,5-dihydroorotate
- (S)-4-pyrimidinecarboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 5988-19-2
- CAS : 155-54-4
- BIGG : dhor__S
- PUBCHEM:
- HMDB : HMDB00528
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC30864
"C1(C(=O)NC(=O)NC(C(=O)[O-])1)" cannot be used as a page name in this wiki.