Difference between revisions of "RXN-11570"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] == * smiles: ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11570 RXN-11570] == * direction: ** LEFT-TO-RIGHT * common name: ** n-acetylglucosamine-6-sulfa...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11570 RXN-11570] ==
* smiles:
+
* direction:
** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J
+
 
* common name:
 
* common name:
** 4-trans-undecenoyl-CoA
+
** n-acetylglucosamine-6-sulfatase
* molecular weight:
+
* ec number:
** 929.765   
+
** [http://enzyme.expasy.org/EC/3.1.6.14 EC-3.1.6.14]
 
* Synonym(s):
 
* Synonym(s):
** 4E-undecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-14789]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[Keratan-sulfate-NAcGlcN6S]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Keratan-sulfate-NAcGlc]][c] '''+''' 1 [[SULFATE]][c] '''+''' 1 [[PROTON]][c]
* [[RXN-14788]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 [keratan sulfate]-α-N-acetyl-D-glucosamine 6-O-sulfate[c] '''+''' 1 H2O[c] '''=>''' 1 [keratan sulfate]-α-N-acetyl-D-glucosamine[c] '''+''' 1 sulfate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18170]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658640 90658640]
+
{{#set: common name=n-acetylglucosamine-6-sulfatase}}
{{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: ec number=EC-3.1.6.14}}
{{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J}}
+
{{#set: gene associated=Tiso_gene_18170}}
{{#set: common name=4-trans-undecenoyl-CoA}}
+
{{#set: in pathway=}}
{{#set: molecular weight=929.765    }}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=4E-undecenoyl-CoA}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: consumed by=RXN-14789}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: produced by=RXN-14788}}
+

Latest revision as of 19:54, 21 March 2018

Reaction RXN-11570

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • n-acetylglucosamine-6-sulfatase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links