Difference between revisions of "CPD-16954"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13864 == * Synonym(s): == Reactions associated == * RXN-11109 ** in-silico_annotation ***ec-number == Pathways associated == == Extern...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] == * smiles: ** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] == |
+ | * smiles: | ||
+ | ** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2)) | ||
+ | * common name: | ||
+ | ** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate | ||
+ | * inchi key: | ||
+ | ** InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K | ||
+ | * molecular weight: | ||
+ | ** 380.17 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-15733]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657876 90657876] | ||
+ | {{#set: smiles=CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))}} | ||
+ | {{#set: common name=[1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate}} | ||
+ | {{#set: inchi key=InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K}} | ||
+ | {{#set: molecular weight=380.17 }} | ||
+ | {{#set: produced by=RXN-15733}} |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-16954
- smiles:
- CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))
- common name:
- [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate
- inchi key:
- InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K
- molecular weight:
- 380.17
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))" cannot be used as a page name in this wiki.
"1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate" cannot be used as a page name in this wiki.