Difference between revisions of "Tiso gene 19356"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] == * smiles: ** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=...")
(Created page with "Category:Gene == Gene Tiso_gene_19356 == * Synonym(s): == Reactions associated == * Reaction: 2.5.1.58-RXN ** Source: orthology-esiliculosus == Pathways associate...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] ==
+
== Gene Tiso_gene_19356 ==
* smiles:
+
** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))
+
* inchi key:
+
** InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K
+
* common name:
+
** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate
+
* molecular weight:
+
** 380.17   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.5.1.58-RXN]]
* [[RXN-15733]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=2.5.1.58-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657876 90657876]
+
{{#set: smiles=CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))}}
+
{{#set: inchi key=InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K}}
+
{{#set: common name=[1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate}}
+
{{#set: molecular weight=380.17    }}
+
{{#set: produced by=RXN-15733}}
+

Latest revision as of 20:54, 21 March 2018

Gene Tiso_gene_19356

  • Synonym(s):

Reactions associated

Pathways associated

External links