Difference between revisions of "RXN-10059"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == * smiles: ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) * inc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10059 RXN-10059] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase * ec num...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10059 RXN-10059] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-oxoacyl-synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[PROTON]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[Lignoceroyl-ACPs]][c] '''=>''' 1 [[3-oxo-cerotoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H+[c] '''+''' 1 malonyl-CoA[c] '''+''' 1 a lignoceroyl-[acp][c] '''=>''' 1 a 3-oxo-cerotoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 coenzyme A[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_15991]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_19302]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_14485]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_5939]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-6113]], superpathway of mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6113 PWY-6113] | ||
+ | ** '''8''' reactions found over '''12''' reactions in the full pathway | ||
+ | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
+ | ** '''86''' reactions found over '''182''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=3-oxoacyl-synthase}} | |
− | + | {{#set: ec number=EC-2.3.1.41}} | |
− | + | {{#set: gene associated=Tiso_gene_15991|Tiso_gene_19302|Tiso_gene_14485|Tiso_gene_5939}} | |
− | + | {{#set: in pathway=PWY-6113|PWYG-321}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:54, 21 March 2018
Contents
Reaction RXN-10059
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-oxoacyl-synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 MALONYL-COA[c] + 1 Lignoceroyl-ACPs[c] => 1 3-oxo-cerotoyl-ACPs[c] + 1 CARBON-DIOXIDE[c] + 1 CO-A[c]
- With common name(s):
- 1 H+[c] + 1 malonyl-CoA[c] + 1 a lignoceroyl-[acp][c] => 1 a 3-oxo-cerotoyl-[acp][c] + 1 CO2[c] + 1 coenzyme A[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_15991
- Source: orthology-esiliculosus
- Gene: Tiso_gene_19302
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14485
- Source: orthology-esiliculosus
- Gene: Tiso_gene_5939
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-6113, superpathway of mycolate biosynthesis: PWY-6113
- 8 reactions found over 12 reactions in the full pathway
- PWYG-321, mycolate biosynthesis: PWYG-321
- 86 reactions found over 182 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation