Difference between revisions of "RXN-11195"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11195 RXN-11195] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF ** cytochrome_b5_reduct...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11195 RXN-11195] ==
* smiles:
+
* direction:
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
+
 
* common name:
 
* common name:
** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
+
** ORF
* molecular weight:
+
** cytochrome_b5_reductase
** 427.646   
+
** nadh-cytochrome_b5reductase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.6.2.2 EC-1.6.2.2]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-318]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[NADH]][c] '''+''' 2 [[Ferrihemoglobins]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[PROTON]][c] '''+''' 2 [[Ferrohemoglobins]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADH[c] '''+''' 2 a ferrihemoglobin[c] '''=>''' 1 NAD+[c] '''+''' 1 H+[c] '''+''' 2 a ferrohemoglobin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7152]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Tiso_gene_8773]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Tiso_gene_19905]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6189]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076]
+
{{#set: common name=ORF}}
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: common name=cytochrome_b5_reductase}}
{{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}}
+
{{#set: common name=nadh-cytochrome_b5reductase}}
{{#set: common name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: ec number=EC-1.6.2.2}}
{{#set: molecular weight=427.646    }}
+
{{#set: gene associated=Tiso_gene_7152|Tiso_gene_8773|Tiso_gene_19905|Tiso_gene_6189}}
{{#set: consumed by=RXN66-318}}
+
{{#set: in pathway=}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:54, 21 March 2018

Reaction RXN-11195

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
    • cytochrome_b5_reductase
    • nadh-cytochrome_b5reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links