Difference between revisions of "URACIL-PRIBOSYLTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-420 CPD-420] == * smiles: ** CC(NC(C(=O)[O-])CC(=O)[O-])=O * inchi key: ** InChIKey=OTCCIMW...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=URACIL-PRIBOSYLTRANS-RXN URACIL-PRIBOSYLTRANS-RXN] == * direction: ** LEFT-TO-RIGHT * common name:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=URACIL-PRIBOSYLTRANS-RXN URACIL-PRIBOSYLTRANS-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** uracil_phosphoribosyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.2.9 EC-2.4.2.9] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[URACIL]][c] '''+''' 1 [[PRPP]][c] '''=>''' 1 [[UMP]][c] '''+''' 1 [[PPI]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 uracil[c] '''+''' 1 5-phospho-α-D-ribose 1-diphosphate[c] '''=>''' 1 UMP[c] '''+''' 1 diphosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10462]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_14867]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7183]], pyrimidine nucleobases salvage I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7183 PWY-7183] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13017 13017] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00966 R00966] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P0A8F0 P0A8F0] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P39765 P39765] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9CEC9 Q9CEC9] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P47276 P47276] |
− | * | + | ** [http://www.uniprot.org/uniprot/O27186 O27186] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43857 P43857] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O67914 O67914] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P44722 P44722] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PN13 Q9PN13] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P65941 P65941] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P39149 P39149] |
+ | ** [http://www.uniprot.org/uniprot/P18562 P18562] | ||
+ | ** [http://www.uniprot.org/uniprot/P41007 P41007] | ||
+ | ** [http://www.uniprot.org/uniprot/P72753 P72753] | ||
+ | ** [http://www.uniprot.org/uniprot/Q55758 Q55758] | ||
+ | ** [http://www.uniprot.org/uniprot/P93394 P93394] | ||
+ | ** [http://www.uniprot.org/uniprot/O65583 O65583] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=uracil_phosphoribosyltransferase}} | ||
+ | {{#set: ec number=EC-2.4.2.9}} | ||
+ | {{#set: gene associated=Tiso_gene_10462|Tiso_gene_14867}} | ||
+ | {{#set: in pathway=PWY-7183}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=orthology-creinhardtii|orthology-athaliana|annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:54, 21 March 2018
Contents
Reaction URACIL-PRIBOSYLTRANS-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- uracil_phosphoribosyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 uracil[c] + 1 5-phospho-α-D-ribose 1-diphosphate[c] => 1 UMP[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10462
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-athaliana
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14867
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY-7183, pyrimidine nucleobases salvage I: PWY-7183
- 1 reactions found over 1 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: