Difference between revisions of "CPD-14925"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18542 == * Synonym(s): == Reactions associated == * RXN-14264 ** pantograph-esiliculosus * RXN0-2301 ** pantograph-e...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14925 CPD-14925] == * smiles: ** CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14925 CPD-14925] == |
| + | * smiles: | ||
| + | ** CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O | ||
| + | * common name: | ||
| + | ** 3-cis-decenoyl-CoA | ||
| + | * inchi key: | ||
| + | ** InChIKey=CQGVNMQHZQJNII-UUSBZYPOSA-J | ||
| + | * molecular weight: | ||
| + | ** 915.738 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (3Z)-dec-3-enoyl-CoA | ||
| + | ** 10:1(n-7)-CoA | ||
| + | ** 10:1-Δ3-CoA | ||
| + | ** (3Z)-decenoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-17799]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659267 90659267] |
| + | {{#set: smiles=CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | ||
| + | {{#set: common name=3-cis-decenoyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=CQGVNMQHZQJNII-UUSBZYPOSA-J}} | ||
| + | {{#set: molecular weight=915.738 }} | ||
| + | {{#set: common name=(3Z)-dec-3-enoyl-CoA|10:1(n-7)-CoA|10:1-Δ3-CoA|(3Z)-decenoyl-CoA}} | ||
| + | {{#set: produced by=RXN-17799}} | ||
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-14925
- smiles:
- CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- common name:
- 3-cis-decenoyl-CoA
- inchi key:
- InChIKey=CQGVNMQHZQJNII-UUSBZYPOSA-J
- molecular weight:
- 915.738
- Synonym(s):
- (3Z)-dec-3-enoyl-CoA
- 10:1(n-7)-CoA
- 10:1-Δ3-CoA
- (3Z)-decenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
