Difference between revisions of "RXN-14394"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14394 RXN-14394] == * direction: ** LEFT-TO-RIGHT * common name: ** acetyl-_c-acetyltransferase...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14394 RXN-14394] ==
−
* smiles:
+
* direction:
−
** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 4-hydroxy-2-nonenal-[Cys-Gly] conjugate
+
** acetyl-_c-acetyltransferase
−
* molecular weight:
+
** 3-ketoacyl-_thiolase
−
** 334.43   
+
** thiolase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.16 EC-2.3.1.16]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-13677]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-15244]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[CPD-7221]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 3-oxo-(5Z)-tetradecenoyl-CoA[c] '''+''' 1 coenzyme A[c] '''=>''' 1 acetyl-CoA[c] '''+''' 1 3-cis-dodecenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10116]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_15327]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_17451]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_3856]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_3855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659346 90659346]
+
{{#set: common name=acetyl-_c-acetyltransferase}}
−
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O}}
+
{{#set: common name=3-ketoacyl-_thiolase}}
−
{{#set: inchi key=InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N}}
+
{{#set: common name=thiolase}}
−
{{#set: common name=4-hydroxy-2-nonenal-[Cys-Gly] conjugate}}
+
{{#set: ec number=EC-2.3.1.16}}
−
{{#set: molecular weight=334.43    }}
+
{{#set: gene associated=Tiso_gene_10116|Tiso_gene_15327|Tiso_gene_17451|Tiso_gene_3856|Tiso_gene_3855}}
−
{{#set: consumed by=RXN-13677}}
+
{{#set: in pathway=}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:54, 21 March 2018

Reaction RXN-14394

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acetyl-_c-acetyltransferase
    • 3-ketoacyl-_thiolase
    • thiolase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3-oxo-(5Z)-tetradecenoyl-CoA[c] + 1 coenzyme A[c] => 1 acetyl-CoA[c] + 1 3-cis-dodecenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14394&oldid=44578"