Difference between revisions of "L-PANTOATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14181 RXN-14181] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] == * smiles: ** CC(C)(CO)C(C([O-])=O)O * common name: ** (R)-pantoate *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14181 RXN-14181] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)(CO)C(C([O-])=O)O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/3.1.3.74 EC-3.1.3.74]
+
** (R)-pantoate
 +
* inchi key:
 +
** InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
 +
* molecular weight:
 +
** 147.15   
 
* Synonym(s):
 
* Synonym(s):
 +
** pantoate
 +
** L-pantoate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
−
** 1 [[WATER]][c] '''+''' 1 [[PYRIDOXINE-5P]][c] '''=>''' 1 [[PYRIDOXINE]][c] '''+''' 1 [[Pi]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
−
** 1 H2O[c] '''+''' 1 pyridoxine 5'-phosphate[c] '''=>''' 1 pyridoxine[c] '''+''' 1 phosphate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_18054]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
* [[PWY-7204]], pyridoxal 5'-phosphate salvage II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 470-29-1
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25113 25113]
+
* DRUGBANK : DB01930
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-3.1.3.74}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289105 5289105]
−
{{#set: gene associated=Tiso_gene_18054}}
+
* LIGAND-CPD:
−
{{#set: in pathway=PWY-7204}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00522 C00522]
−
{{#set: reconstruction category=orthology}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
** [http://www.chemspider.com/Chemical-Structure.4451134.html 4451134]
−
{{#set: reconstruction tool=pantograph}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15980 15980]
 +
* BIGG : pant__R
 +
{{#set: smiles=CC(C)(CO)C(C([O-])=O)O}}
 +
{{#set: common name=(R)-pantoate}}
 +
{{#set: inchi key=InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M}}
 +
{{#set: molecular weight=147.15    }}
 +
{{#set: common name=pantoate|L-pantoate}}
 +
{{#set: consumed by=PANTOATE-BETA-ALANINE-LIG-RXN}}
 +
{{#set: produced by=2-DEHYDROPANTOATE-REDUCT-RXN}}

Latest revision as of 19:54, 21 March 2018

Metabolite L-PANTOATE

  • smiles:
    • CC(C)(CO)C(C([O-])=O)O
  • common name:
    • (R)-pantoate
  • inchi key:
    • InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
  • molecular weight:
    • 147.15
  • Synonym(s):
    • pantoate
    • L-pantoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(CO)C(C([O-])=O)O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-PANTOATE&oldid=44582"