Difference between revisions of "N-5-PHOSPHORIBOSYL-ANTHRANILATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCERALD GLYCERALD] == * smiles: ** [CH](=O)C(O)CO * inchi key: ** InChIKey=MNQZXJOMYWMBOU-VKH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] == * smiles: ** C(OP(=O)([O-])...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] == |
* smiles: | * smiles: | ||
− | ** [ | + | ** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)NC2(C=CC=CC(C(=O)[O-])=2)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** N-(5-phosphoribosyl)-anthranilate |
+ | * inchi key: | ||
+ | ** InChIKey=PMFMJXPRNJUYMB-GWOFURMSSA-K | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 346.21 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** N-(5-phospho-D-ribosyl)-anthranilate |
− | ** | + | ** N-(5-phospho-β-D-ribosyl)-anthranilate |
− | ** | + | ** 5-phosphoribosyl-anthranilate |
− | ** | + | ** 5-P-ribosyl-anthranilate |
− | ** | + | ** 5'-phosphoribosyl-anthranilate |
− | ** | + | ** 5'-P-ribosyl-anthranilate |
− | ** | + | ** N-(5-phosphoribosyl)-anthranilate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PRAISOM-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[PRTRANS-RXN]] |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548600 9548600] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18277 18277] |
− | * BIGG : | + | * BIGG : pran |
− | {{#set: smiles=[ | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04302 C04302] |
− | {{#set: | + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)NC2(C=CC=CC(C(=O)[O-])=2))}} |
− | {{#set: molecular weight= | + | {{#set: common name=N-(5-phosphoribosyl)-anthranilate}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=PMFMJXPRNJUYMB-GWOFURMSSA-K}} |
− | {{#set: consumed by= | + | {{#set: molecular weight=346.21 }} |
− | + | {{#set: common name=N-(5-phospho-D-ribosyl)-anthranilate|N-(5-phospho-β-D-ribosyl)-anthranilate|5-phosphoribosyl-anthranilate|5-P-ribosyl-anthranilate|5'-phosphoribosyl-anthranilate|5'-P-ribosyl-anthranilate|N-(5-phosphoribosyl)-anthranilate}} | |
− | {{#set: reversible reaction associated= | + | {{#set: consumed by=PRAISOM-RXN}} |
+ | {{#set: reversible reaction associated=PRTRANS-RXN}} |
Latest revision as of 19:55, 21 March 2018
Contents
Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE
- smiles:
- C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)NC2(C=CC=CC(C(=O)[O-])=2))
- common name:
- N-(5-phosphoribosyl)-anthranilate
- inchi key:
- InChIKey=PMFMJXPRNJUYMB-GWOFURMSSA-K
- molecular weight:
- 346.21
- Synonym(s):
- N-(5-phospho-D-ribosyl)-anthranilate
- N-(5-phospho-β-D-ribosyl)-anthranilate
- 5-phosphoribosyl-anthranilate
- 5-P-ribosyl-anthranilate
- 5'-phosphoribosyl-anthranilate
- 5'-P-ribosyl-anthranilate
- N-(5-phosphoribosyl)-anthranilate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)NC2(C=CC=CC(C(=O)[O-])=2))" cannot be used as a page name in this wiki.