Difference between revisions of "CPD-7367"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == * smiles: ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == * smiles: ** [CH](=O)C1(=CC=C(O)C(N)=C1) * common name: ** 3-amino-4-hydr...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [CH](=O)C1(=CC=C(O)C(N)=C1) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-amino-4-hydroxybenzaldehyde |
| + | * inchi key: | ||
| + | ** InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 137.138 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-13871]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11521082 11521082] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78237 78237] |
| − | {{#set: smiles= | + | {{#set: smiles=[CH](=O)C1(=CC=C(O)C(N)=C1)}} |
| − | {{#set: | + | {{#set: common name=3-amino-4-hydroxybenzaldehyde}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=137.138 }} |
| − | {{#set: | + | {{#set: reversible reaction associated=RXN-13871}} |
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite CPD-7367
- smiles:
- [CH](=O)C1(=CC=C(O)C(N)=C1)
- common name:
- 3-amino-4-hydroxybenzaldehyde
- inchi key:
- InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N
- molecular weight:
- 137.138
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C1(=CC=C(O)C(N)=C1)" cannot be used as a page name in this wiki.
